C22H26N4O4S — CID 17398748
N-[4-(diethylsulfamoyl)phenyl]-4-oxo-3-propylphthalazine-1-carboxamide (PubChem CID 17398748) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-4-oxo-3-propylphthalazine-1-carboxamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-4-oxo-3-propylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 17398748 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-4-oxo-3-propylphthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)Nc2ccc(S(=O)(=O)N(CC)CC)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H26N4O4S/c1-4-15-26-22(28)19-10-8-7-9-18(19)20(24-26)21(27)23-16-11-13-17(14-12-16)31(29,30)25(5-2)6-3/h7-14H,4-6,15H2,1-3H3,(H,23,27) |
| InChIKey | SGDFRNMLOZPYKZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |