C26H23NO4S — CID 56522776
5-(benzenesulfonylmethyl)-N-(1,1-diphenylethyl)furan-2-carboxamide (PubChem CID 56522776) has the molecular formula C26H23NO4S and a molecular weight of 445.54 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-(1,1-diphenylethyl)furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-(1,1-diphenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 56522776 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-(1,1-diphenylethyl)furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23NO4S/c1-26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)27-25(28)24-18-17-22(31-24)19-32(29,30)23-15-9-4-10-16-23/h2-18H,19H2,1H3,(H,27,28) |
| InChIKey | XHGCFUYQICTAKG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |