C22H22N2O4S — CID 9350129
5-(benzenesulfonylmethyl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 9350129) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9350129 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[(Z)-(4-propan-2-ylphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(/C=N\NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-16(2)18-10-8-17(9-11-18)14-23-24-22(25)21-13-12-19(28-21)15-29(26,27)20-6-4-3-5-7-20/h3-14,16H,15H2,1-2H3,(H,24,25)/b23-14- |
| InChIKey | KHSMSOVUOJKNSE-UCQKPKSFSA-N |
| XLogP | 4.14 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|