C18H16N2O4S2 — CID 9350236
5-(benzenesulfonylmethyl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]furan-2-carboxamide (PubChem CID 9350236) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9350236 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[(Z)-(5-methylthiophen-2-yl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)s1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-13-7-9-15(25-13)11-19-20-18(21)17-10-8-14(24-17)12-26(22,23)16-5-3-2-4-6-16/h2-11H,12H2,1H3,(H,20,21)/b19-11- |
| InChIKey | KGTFOOHYLZEEHL-ODLFYWEKSA-N |
| XLogP | 3.39 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|