C19H22N2O4S — CID 9350231
5-(benzenesulfonylmethyl)-N-[[(2S)-2-methylcyclohexylidene]amino]furan-2-carboxamide (PubChem CID 9350231) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[[(2S)-2-methylcyclohexylidene]amino]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[[(2S)-2-methylcyclohexylidene]amino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9350231 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[[(2S)-2-methylcyclohexylidene]amino]furan-2-carboxamide |
| SMILES | C[C@H]1CCCCC1=NNC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C19H22N2O4S/c1-14-7-5-6-10-17(14)20-21-19(22)18-12-11-15(25-18)13-26(23,24)16-8-3-2-4-9-16/h2-4,8-9,11-12,14H,5-7,10,13H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | BVOFVAPUYQASQC-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|