C18H21NO4S — CID 4790235
azepan-1-yl-[5-(benzenesulfonylmethyl)furan-2-yl]methanone (PubChem CID 4790235) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is azepan-1-yl-[5-(benzenesulfonylmethyl)furan-2-yl]methanone.
| Compound Name | azepan-1-yl-[5-(benzenesulfonylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 4790235 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | azepan-1-yl-[5-(benzenesulfonylmethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(CS(=O)(=O)c2ccccc2)o1)N1CCCCCC1 |
| InChI | InChI=1S/C18H21NO4S/c20-18(19-12-6-1-2-7-13-19)17-11-10-15(23-17)14-24(21,22)16-8-4-3-5-9-16/h3-5,8-11H,1-2,6-7,12-14H2 |
| InChIKey | MXPBGDVMHISUJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |