C22H27BrN2O4S — CID 3593661
[5-[(4-bromophenyl)sulfonylmethyl]furan-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone (PubChem CID 3593661) has the molecular formula C22H27BrN2O4S and a molecular weight of 495.44 g/mol. Its IUPAC name is [5-[(4-bromophenyl)sulfonylmethyl]furan-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone.
| Compound Name | [5-[(4-bromophenyl)sulfonylmethyl]furan-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 3593661 |
| Molecular Formula | C22H27BrN2O4S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | [5-[(4-bromophenyl)sulfonylmethyl]furan-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(CS(=O)(=O)c2ccc(Br)cc2)o1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H27BrN2O4S/c23-17-6-9-20(10-7-17)30(27,28)16-19-8-11-21(29-19)22(26)25-14-12-24(13-15-25)18-4-2-1-3-5-18/h6-11,18H,1-5,12-16H2 |
| InChIKey | MUMGLGDCUXUIKB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |