C17H19NO4S — CID 20859632
[5-[(2-methylphenyl)sulfonylmethyl]furan-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 20859632) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is [5-[(2-methylphenyl)sulfonylmethyl]furan-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[(2-methylphenyl)sulfonylmethyl]furan-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 20859632 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [5-[(2-methylphenyl)sulfonylmethyl]furan-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccccc1S(=O)(=O)Cc1ccc(C(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C17H19NO4S/c1-13-6-2-3-7-16(13)23(20,21)12-14-8-9-15(22-14)17(19)18-10-4-5-11-18/h2-3,6-9H,4-5,10-12H2,1H3 |
| InChIKey | SUUIUSTWNBJTRW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |