C17H19NO6S — CID 5308528
[5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-yl]-morpholin-4-ylmethanone (PubChem CID 5308528) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 5308528 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccccc1S(=O)(=O)Cc1ccc(C(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C17H19NO6S/c1-22-14-4-2-3-5-16(14)25(20,21)12-13-6-7-15(24-13)17(19)18-8-10-23-11-9-18/h2-7H,8-12H2,1H3 |
| InChIKey | SIDWQGKZYWNKDW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |