C26H30FN3O5S — CID 20859714
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-carboxamide (PubChem CID 20859714) has the molecular formula C26H30FN3O5S and a molecular weight of 515.61 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20859714 |
| Molecular Formula | C26H30FN3O5S |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-5-[(2-methoxyphenyl)sulfonylmethyl]furan-2-carboxamide |
| SMILES | COc1ccccc1S(=O)(=O)Cc1ccc(C(=O)NCCCN2CCN(c3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C26H30FN3O5S/c1-34-23-5-2-3-6-25(23)36(32,33)19-22-11-12-24(35-22)26(31)28-13-4-14-29-15-17-30(18-16-29)21-9-7-20(27)8-10-21/h2-3,5-12H,4,13-19H2,1H3,(H,28,31) |
| InChIKey | LPWVSYOHQVFURV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|