C21H25NO4S — CID 51157629
5-(benzenesulfonylmethyl)-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]furan-2-carboxamide (PubChem CID 51157629) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51157629 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1)C1CC2CCC1C2 |
| InChI | InChI=1S/C21H25NO4S/c1-14(19-12-15-7-8-16(19)11-15)22-21(23)20-10-9-17(26-20)13-27(24,25)18-5-3-2-4-6-18/h2-6,9-10,14-16,19H,7-8,11-13H2,1H3,(H,22,23) |
| InChIKey | CWRQSIWNMOPZHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |