C21H24N2O5 — CID 98422492
N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 98422492) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 98422492 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc(COc2ccccc2[N+](=O)[O-])o1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C21H24N2O5/c1-13(17-11-14-6-7-15(17)10-14)22-21(24)20-9-8-16(28-20)12-27-19-5-3-2-4-18(19)23(25)26/h2-5,8-9,13-15,17H,6-7,10-12H2,1H3,(H,22,24)/t13-,14-,15-,17+/m0/s1 |
| InChIKey | PKMHMFHJFCRIFU-QBYUYEEZSA-N |
| XLogP | 4.32 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|