C14H18N2O4 — CID 2404747
N-[(1S)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitrofuran-2-carboxamide (PubChem CID 2404747) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[(1S)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 2404747 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[(1S)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitrofuran-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc([N+](=O)[O-])o1)[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C14H18N2O4/c1-8(11-7-9-2-3-10(11)6-9)15-14(17)12-4-5-13(20-12)16(18)19/h4-5,8-11H,2-3,6-7H2,1H3,(H,15,17)/t8-,9-,10+,11-/m0/s1 |
| InChIKey | KTTCCWLVXJXHBZ-MMWGEVLESA-N |
| XLogP | 2.74 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|