C17H22N2O3 — CID 98752047
N-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(2-nitrophenyl)acetamide (PubChem CID 98752047) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98752047 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-(2-nitrophenyl)acetamide |
| SMILES | C[C@H](NC(=O)Cc1ccccc1[N+](=O)[O-])[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H22N2O3/c1-11(15-9-12-6-7-13(15)8-12)18-17(20)10-14-4-2-3-5-16(14)19(21)22/h2-5,11-13,15H,6-10H2,1H3,(H,18,20)/t11-,12-,13-,15-/m0/s1 |
| InChIKey | YMSBRJGKVQVWEU-ABHRYQDASA-N |
| XLogP | 3.08 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|