C21H24FNO3 — CID 19580094
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19580094) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19580094 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(COc2ccc(F)cc2)o1)C1CC2CCC1C2 |
| InChI | InChI=1S/C21H24FNO3/c1-13(19-11-14-2-3-15(19)10-14)23-21(24)20-9-8-18(26-20)12-25-17-6-4-16(22)5-7-17/h4-9,13-15,19H,2-3,10-12H2,1H3,(H,23,24) |
| InChIKey | HXFYSWZNANTAMI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |