C20H18N2O6S — CID 135788139
5-(benzenesulfonylmethyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 135788139) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 135788139 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)c1O |
| InChI | InChI=1S/C20H18N2O6S/c1-27-17-9-5-6-14(19(17)23)12-21-22-20(24)18-11-10-15(28-18)13-29(25,26)16-7-3-2-4-8-16/h2-12,23H,13H2,1H3,(H,22,24)/b21-12+ |
| InChIKey | XOTDCIOSXSVTOK-CIAFOILYSA-N |
| XLogP | 2.73 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|