C22H21ClN2O5 — CID 6874399
5-[(2-chlorophenoxy)methyl]-N-[(E)-(2,4-dimethoxy-3-methylphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 6874399) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 5-[(2-chlorophenoxy)methyl]-N-[(E)-(2,4-dimethoxy-3-methylphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(2-chlorophenoxy)methyl]-N-[(E)-(2,4-dimethoxy-3-methylphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6874399 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-[(2-chlorophenoxy)methyl]-N-[(E)-(2,4-dimethoxy-3-methylphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc(COc3ccccc3Cl)o2)c(OC)c1C |
| InChI | InChI=1S/C22H21ClN2O5/c1-14-18(27-2)10-8-15(21(14)28-3)12-24-25-22(26)20-11-9-16(30-20)13-29-19-7-5-4-6-17(19)23/h4-12H,13H2,1-3H3,(H,25,26)/b24-12+ |
| InChIKey | ALSZPRQIWXWJGV-WYMPLXKRSA-N |
| XLogP | 4.60 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|