C20H15F3N2O5S — CID 27812757
5-(benzenesulfonylmethyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide (PubChem CID 27812757) has the molecular formula C20H15F3N2O5S and a molecular weight of 452.41 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27812757 |
| Molecular Formula | C20H15F3N2O5S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H15F3N2O5S/c21-14-7-8-15(19(23)18(14)22)25-17(26)10-24-20(27)16-9-6-12(30-16)11-31(28,29)13-4-2-1-3-5-13/h1-9H,10-11H2,(H,24,27)(H,25,26) |
| InChIKey | UZJOLHWSHVROGB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|