C16H18ClNO5S — CID 4084510
5-[(4-chlorophenyl)methylsulfonylmethyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 4084510) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfonylmethyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)methylsulfonylmethyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4084510 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfonylmethyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(CS(=O)(=O)Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C16H18ClNO5S/c1-22-9-8-18-16(19)15-7-6-14(23-15)11-24(20,21)10-12-2-4-13(17)5-3-12/h2-7H,8-11H2,1H3,(H,18,19) |
| InChIKey | IKRGYOINSWNWGT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|