C16H16F3NO5S — CID 20859726
N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide (PubChem CID 20859726) has the molecular formula C16H16F3NO5S and a molecular weight of 391.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20859726 |
| Molecular Formula | C16H16F3NO5S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-(2-methoxyethyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(CS(=O)(=O)c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H16F3NO5S/c1-24-8-7-20-15(21)14-6-5-12(25-14)10-26(22,23)13-4-2-3-11(9-13)16(17,18)19/h2-6,9H,7-8,10H2,1H3,(H,20,21) |
| InChIKey | JBRVEDABOVYBGX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|