C20H23F3N2O5S — CID 3244186
N-(3-morpholin-4-ylpropyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide (PubChem CID 3244186) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3244186 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-5-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]furan-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(CS(=O)(=O)c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H23F3N2O5S/c21-20(22,23)15-3-1-4-17(13-15)31(27,28)14-16-5-6-18(30-16)19(26)24-7-2-8-25-9-11-29-12-10-25/h1,3-6,13H,2,7-12,14H2,(H,24,26) |
| InChIKey | LOGZYAQWRSCUDZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|