C16H25N3O6S — CID 35993608
N-(3-morpholin-4-ylpropyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 35993608) has the molecular formula C16H25N3O6S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 35993608 |
| Molecular Formula | C16H25N3O6S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C16H25N3O6S/c20-16(17-4-1-5-18-6-10-23-11-7-18)14-2-3-15(25-14)26(21,22)19-8-12-24-13-9-19/h2-3H,1,4-13H2,(H,17,20) |
| InChIKey | NXSRSPHJNWKAAX-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|