C22H22N2O6S — CID 39576917
5-morpholin-4-ylsulfonyl-N-[(3-phenoxyphenyl)methyl]furan-2-carboxamide (PubChem CID 39576917) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-N-[(3-phenoxyphenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-morpholin-4-ylsulfonyl-N-[(3-phenoxyphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39576917 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-N-[(3-phenoxyphenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccc(Oc2ccccc2)c1)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C22H22N2O6S/c25-22(20-9-10-21(30-20)31(26,27)24-11-13-28-14-12-24)23-16-17-5-4-8-19(15-17)29-18-6-2-1-3-7-18/h1-10,15H,11-14,16H2,(H,23,25) |
| InChIKey | RWXOEBHXFZFRIC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |