C15H16N2O6S — CID 84578663
N-(2-hydroxyphenyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 84578663) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 84578663 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-(2-hydroxyphenyl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C15H16N2O6S/c18-12-4-2-1-3-11(12)16-15(19)13-5-6-14(23-13)24(20,21)17-7-9-22-10-8-17/h1-6,18H,7-10H2,(H,16,19) |
| InChIKey | IRMRZPXIOVDZSQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|