C17H17N3O5S — CID 112526632
N-(1H-indol-7-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 112526632) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-(1H-indol-7-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(1H-indol-7-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112526632 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(1H-indol-7-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(Nc1cccc2cc[nH]c12)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C17H17N3O5S/c21-17(19-13-3-1-2-12-6-7-18-16(12)13)14-4-5-15(25-14)26(22,23)20-8-10-24-11-9-20/h1-7,18H,8-11H2,(H,19,21) |
| InChIKey | NGWHHWHTWBQSCR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |