C18H20N2O7S — CID 56576104
methyl 2-hydroxy-3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate (PubChem CID 56576104) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 56576104 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | methyl 2-hydroxy-3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)c1O |
| InChI | InChI=1S/C18H20N2O7S/c1-26-18(23)12-6-5-7-13(16(12)21)19-17(22)14-8-9-15(27-14)28(24,25)20-10-3-2-4-11-20/h5-9,21H,2-4,10-11H2,1H3,(H,19,22) |
| InChIKey | MLZJMLDGLDCJMN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|