C10H13NO5S — CID 716787
methyl 5-pyrrolidin-1-ylsulfonylfuran-2-carboxylate (PubChem CID 716787) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is methyl 5-pyrrolidin-1-ylsulfonylfuran-2-carboxylate.
| Compound Name | methyl 5-pyrrolidin-1-ylsulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 716787 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | methyl 5-pyrrolidin-1-ylsulfonylfuran-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C10H13NO5S/c1-15-10(12)8-4-5-9(16-8)17(13,14)11-6-2-3-7-11/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | HMSOKIUTJPROQQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |