C17H20N2O6S2 — CID 55630451
N-(4-methylsulfonylphenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55630451) has the molecular formula C17H20N2O6S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(4-methylsulfonylphenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55630451 |
| Molecular Formula | C17H20N2O6S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C17H20N2O6S2/c1-26(21,22)14-7-5-13(6-8-14)18-17(20)15-9-10-16(25-15)27(23,24)19-11-3-2-4-12-19/h5-10H,2-4,11-12H2,1H3,(H,18,20) |
| InChIKey | TXMHLRPGIWTSOE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |