C17H18N2O6S — CID 46547480
methyl 4-[(5-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate (PubChem CID 46547480) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is methyl 4-[(5-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(5-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 46547480 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | methyl 4-[(5-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCCC3)o2)cc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-24-17(21)12-4-6-13(7-5-12)18-16(20)14-8-9-15(25-14)26(22,23)19-10-2-3-11-19/h4-9H,2-3,10-11H2,1H3,(H,18,20) |
| InChIKey | JLXCVTWVWKAABS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |