C19H23N3O7S — CID 55783915
N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55783915) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55783915 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)cc1OCC(N)=O |
| InChI | InChI=1S/C19H23N3O7S/c1-27-14-6-5-13(11-16(14)28-12-17(20)23)21-19(24)15-7-8-18(29-15)30(25,26)22-9-3-2-4-10-22/h5-8,11H,2-4,9-10,12H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | GCTJESDNVIBSIG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |