C19H23N3O5S — CID 55660521
N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55660521) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55660521 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[2-methyl-3-(methylcarbamoyl)phenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)N3CCCCC3)o2)c1C |
| InChI | InChI=1S/C19H23N3O5S/c1-13-14(18(23)20-2)7-6-8-15(13)21-19(24)16-9-10-17(27-16)28(25,26)22-11-4-3-5-12-22/h6-10H,3-5,11-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | ZZFGNUVXSAOGMP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |