C18H21N3O5S2 — CID 55633494
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55633494) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55633494 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)c1ccc(S(=O)(=O)N2CCCCC2)o1 |
| InChI | InChI=1S/C18H21N3O5S2/c19-16(22)12-27-15-7-3-2-6-13(15)20-18(23)14-8-9-17(26-14)28(24,25)21-10-4-1-5-11-21/h2-3,6-9H,1,4-5,10-12H2,(H2,19,22)(H,20,23) |
| InChIKey | RJOFDEQUWBKHOL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |