C16H16Br2N2O4S — CID 55631341
N-(2,4-dibromophenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55631341) has the molecular formula C16H16Br2N2O4S and a molecular weight of 492.19 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55631341 |
| Molecular Formula | C16H16Br2N2O4S |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.92 |
| IUPAC Name | N-(2,4-dibromophenyl)-5-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1Br)c1ccc(S(=O)(=O)N2CCCCC2)o1 |
| InChI | InChI=1S/C16H16Br2N2O4S/c17-11-4-5-13(12(18)10-11)19-16(21)14-6-7-15(24-14)25(22,23)20-8-2-1-3-9-20/h4-7,10H,1-3,8-9H2,(H,19,21) |
| InChIKey | LUWDEBWAGGQFNF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |