C13H18N2O6S — CID 75417895
3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]propanoic acid (PubChem CID 75417895) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is 3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 75417895 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-[(5-piperidin-1-ylsulfonylfuran-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(S(=O)(=O)N2CCCCC2)o1 |
| InChI | InChI=1S/C13H18N2O6S/c16-11(17)6-7-14-13(18)10-4-5-12(21-10)22(19,20)15-8-2-1-3-9-15/h4-5H,1-3,6-9H2,(H,14,18)(H,16,17) |
| InChIKey | KCXDJJRQFQGCES-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |