C15H20N2O5S — CID 119177170
3-[(2-piperidin-1-ylsulfonylbenzoyl)amino]propanoic acid (PubChem CID 119177170) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[(2-piperidin-1-ylsulfonylbenzoyl)amino]propanoic acid.
| Compound Name | 3-[(2-piperidin-1-ylsulfonylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119177170 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[(2-piperidin-1-ylsulfonylbenzoyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H20N2O5S/c18-14(19)8-9-16-15(20)12-6-2-3-7-13(12)23(21,22)17-10-4-1-5-11-17/h2-3,6-7H,1,4-5,8-11H2,(H,16,20)(H,18,19) |
| InChIKey | GQBAVXUGNYWGAK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |