C16H22N2O5S — CID 119223642
2-[(2-piperidin-1-ylsulfonylbenzoyl)amino]butanoic acid (PubChem CID 119223642) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[(2-piperidin-1-ylsulfonylbenzoyl)amino]butanoic acid.
| Compound Name | 2-[(2-piperidin-1-ylsulfonylbenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119223642 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[(2-piperidin-1-ylsulfonylbenzoyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1ccccc1S(=O)(=O)N1CCCCC1)C(=O)O |
| InChI | InChI=1S/C16H22N2O5S/c1-2-13(16(20)21)17-15(19)12-8-4-5-9-14(12)24(22,23)18-10-6-3-7-11-18/h4-5,8-9,13H,2-3,6-7,10-11H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | PZAMUCVHWRCLRC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |