C14H20N2O6S — CID 119223538
2-[(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]butanoic acid (PubChem CID 119223538) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]butanoic acid.
| Compound Name | 2-[(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119223538 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc(S(=O)(=O)N2CCCC2)c(C)o1)C(=O)O |
| InChI | InChI=1S/C14H20N2O6S/c1-3-10(14(18)19)15-13(17)11-8-12(9(2)22-11)23(20,21)16-6-4-5-7-16/h8,10H,3-7H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | NRIIGQLVTGIEIA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |