C18H22N2O5S — CID 94034180
N-[(2S)-2-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 94034180) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-[(2S)-2-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 94034180 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-phenylethyl]-5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)NC[C@@H](O)c2ccccc2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C18H22N2O5S/c1-13-17(26(23,24)20-9-5-6-10-20)11-16(25-13)18(22)19-12-15(21)14-7-3-2-4-8-14/h2-4,7-8,11,15,21H,5-6,9-10,12H2,1H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | ZDDLDXPNJCOZKW-OAHLLOKOSA-N |
| XLogP | 1.84 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |