C15H19N3O5S — CID 49394055
5-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 49394055) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | 5-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 49394055 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-methyl-N-[2-oxo-2-(prop-2-ynylamino)ethyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | C#CCNC(=O)CNC(=O)c1cc(S(=O)(=O)N2CCCC2)c(C)o1 |
| InChI | InChI=1S/C15H19N3O5S/c1-3-6-16-14(19)10-17-15(20)12-9-13(11(2)23-12)24(21,22)18-7-4-5-8-18/h1,9H,4-8,10H2,2H3,(H,16,19)(H,17,20) |
| InChIKey | JJWREUCHNQBHBV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|