C13H19N3O5S — CID 46438806
5-(methylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)furan-2-carboxamide (PubChem CID 46438806) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-(methylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)furan-2-carboxamide.
| Compound Name | 5-(methylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46438806 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-(methylsulfamoyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCCC(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C13H19N3O5S/c1-14-22(19,20)12-5-4-10(21-12)13(18)15-7-6-11(17)16-8-2-3-9-16/h4-5,14H,2-3,6-9H2,1H3,(H,15,18) |
| InChIKey | VCXVTWRBWROUHY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |