C20H24N2O6S2 — CID 55667340
ethyl 5-[4-[(2-methylsulfanylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 55667340) has the molecular formula C20H24N2O6S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 5-[4-[(2-methylsulfanylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-[(2-methylsulfanylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55667340 |
| Molecular Formula | C20H24N2O6S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | ethyl 5-[4-[(2-methylsulfanylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccccc3SC)CC2)o1 |
| InChI | InChI=1S/C20H24N2O6S2/c1-3-27-20(24)16-8-9-18(28-16)30(25,26)22-12-10-14(11-13-22)19(23)21-15-6-4-5-7-17(15)29-2/h4-9,14H,3,10-13H2,1-2H3,(H,21,23) |
| InChIKey | HQWJJOYUBRNPOA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |