C18H20BrN3O6S — CID 55756486
ethyl 5-[4-[(5-bromo-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 55756486) has the molecular formula C18H20BrN3O6S and a molecular weight of 486.34 g/mol. Its IUPAC name is ethyl 5-[4-[(5-bromo-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-[(5-bromo-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55756486 |
| Molecular Formula | C18H20BrN3O6S |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | ethyl 5-[4-[(5-bromo-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(Br)cn3)CC2)o1 |
| InChI | InChI=1S/C18H20BrN3O6S/c1-2-27-18(24)14-4-6-16(28-14)29(25,26)22-9-7-12(8-10-22)17(23)21-15-5-3-13(19)11-20-15/h3-6,11-12H,2,7-10H2,1H3,(H,20,21,23) |
| InChIKey | ZNVSFFPHFBTNNK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |