C22H24N4O6S — CID 47045209
ethyl 5-[4-[(2-pyrazol-1-ylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 47045209) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is ethyl 5-[4-[(2-pyrazol-1-ylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-[(2-pyrazol-1-ylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 47045209 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | ethyl 5-[4-[(2-pyrazol-1-ylphenyl)carbamoyl]piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccccc3-n3cccn3)CC2)o1 |
| InChI | InChI=1S/C22H24N4O6S/c1-2-31-22(28)19-8-9-20(32-19)33(29,30)25-14-10-16(11-15-25)21(27)24-17-6-3-4-7-18(17)26-13-5-12-23-26/h3-9,12-13,16H,2,10-11,14-15H2,1H3,(H,24,27) |
| InChIKey | BFQRFYZQEPFJIM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |