C18H27N3O6S — CID 91949851
methyl 5-[4-(2-pyrrolidin-1-ylethylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 91949851) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl 5-[4-(2-pyrrolidin-1-ylethylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | methyl 5-[4-(2-pyrrolidin-1-ylethylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 91949851 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methyl 5-[4-(2-pyrrolidin-1-ylethylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NCCN3CCCC3)CC2)o1 |
| InChI | InChI=1S/C18H27N3O6S/c1-26-18(23)15-4-5-16(27-15)28(24,25)21-11-6-14(7-12-21)17(22)19-8-13-20-9-2-3-10-20/h4-5,14H,2-3,6-13H2,1H3,(H,19,22) |
| InChIKey | YXKXJNIAGPEPPF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |