C16H24N2O7S — CID 119179323
5-[4-(3-ethoxypropylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylic acid (PubChem CID 119179323) has the molecular formula C16H24N2O7S and a molecular weight of 388.44 g/mol. Its IUPAC name is 5-[4-(3-ethoxypropylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-[4-(3-ethoxypropylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 119179323 |
| Molecular Formula | C16H24N2O7S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 5-[4-(3-ethoxypropylcarbamoyl)piperidin-1-yl]sulfonylfuran-2-carboxylic acid |
| SMILES | CCOCCCNC(=O)C1CCN(S(=O)(=O)c2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C16H24N2O7S/c1-2-24-11-3-8-17-15(19)12-6-9-18(10-7-12)26(22,23)14-5-4-13(25-14)16(20)21/h4-5,12H,2-3,6-11H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | TVZZYEOSTWYPNF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|