C16H16N4O5S — CID 112527883
N-(1H-indazol-3-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 112527883) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-(1H-indazol-3-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112527883 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(1H-indazol-3-yl)-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccccc12)c1ccc(S(=O)(=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C16H16N4O5S/c21-16(17-15-11-3-1-2-4-12(11)18-19-15)13-5-6-14(25-13)26(22,23)20-7-9-24-10-8-20/h1-6H,7-10H2,(H2,17,18,19,21) |
| InChIKey | JWEKMYANLBUGMN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |