C20H21F3N2O4S — CID 30125791
N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 30125791) has the molecular formula C20H21F3N2O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 30125791 |
| Molecular Formula | C20H21F3N2O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[2-(4-morpholin-4-ylsulfonylphenyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O4S/c21-20(22,23)17-3-1-2-16(14-17)19(26)24-9-8-15-4-6-18(7-5-15)30(27,28)25-10-12-29-13-11-25/h1-7,14H,8-13H2,(H,24,26) |
| InChIKey | IGXLOWNERWGKNU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |