C19H25Cl2F3N2O2 — CID 17195962
3-morpholin-4-yl-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine;dihydrochloride (PubChem CID 17195962) has the molecular formula C19H25Cl2F3N2O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17195962 |
| Molecular Formula | C19H25Cl2F3N2O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 3-morpholin-4-yl-N-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cccc(-c2ccc(CNCCCN3CCOCC3)o2)c1 |
| InChI | InChI=1S/C19H23F3N2O2.2ClH/c20-19(21,22)16-4-1-3-15(13-16)18-6-5-17(26-18)14-23-7-2-8-24-9-11-25-12-10-24;;/h1,3-6,13,23H,2,7-12,14H2;2*1H |
| InChIKey | MZLJIHLKLWAPTE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|