C19H19F6NO2 — CID 170871315
4-[3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]propyl]morpholine (PubChem CID 170871315) has the molecular formula C19H19F6NO2 and a molecular weight of 407.35 g/mol. Its IUPAC name is 4-[3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]propyl]morpholine.
| Compound Name | 4-[3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]propyl]morpholine |
|---|---|
| PubChem CID | 170871315 |
| Molecular Formula | C19H19F6NO2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-[3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]propyl]morpholine |
| SMILES | FC(F)(F)c1cc(-c2ccc(CCCN3CCOCC3)o2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F6NO2/c20-18(21,22)14-10-13(11-15(12-14)19(23,24)25)17-4-3-16(28-17)2-1-5-26-6-8-27-9-7-26/h3-4,10-12H,1-2,5-9H2 |
| InChIKey | HDQZMFHTKXAICY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |