C15H17F6NO — CID 170869353
4-[3-[2,4-bis(trifluoromethyl)phenyl]propyl]morpholine (PubChem CID 170869353) has the molecular formula C15H17F6NO and a molecular weight of 341.30 g/mol. Its IUPAC name is 4-[3-[2,4-bis(trifluoromethyl)phenyl]propyl]morpholine.
| Compound Name | 4-[3-[2,4-bis(trifluoromethyl)phenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869353 |
| Molecular Formula | C15H17F6NO |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[3-[2,4-bis(trifluoromethyl)phenyl]propyl]morpholine |
| SMILES | FC(F)(F)c1ccc(CCCN2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F6NO/c16-14(17,18)12-4-3-11(13(10-12)15(19,20)21)2-1-5-22-6-8-23-9-7-22/h3-4,10H,1-2,5-9H2 |
| InChIKey | ZQKLHUUANCIBQA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |